C29H22ClNO8 — CID 21001603
[6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 21001603) has the molecular formula C29H22ClNO8 and a molecular weight of 547.95 g/mol. Its IUPAC name is [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 21001603 |
| Molecular Formula | C29H22ClNO8 |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1ccc(-c2oc3cc(C)c(Cl)cc3c(=O)c2OC(=O)CCN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C29H22ClNO8/c1-15-12-22-19(14-20(15)30)25(33)27(26(38-22)16-8-9-21(36-2)23(13-16)37-3)39-24(32)10-11-31-28(34)17-6-4-5-7-18(17)29(31)35/h4-9,12-14H,10-11H2,1-3H3 |
| InChIKey | BHDFYTYERMHQBG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|