3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid

C15H19NO5 — CID 28932844

IUPAC3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCC(=O)N1CCOCC1
InChIInChI=1S/C15H19NO5/c1-10-7-12(15(18)19)8-11(2)14(10)21-9-13(17)16-3-5-20-6-4-16/h7-8H,3-6,9H2,1-2H3,(H,18,19)
InChIKeyJSKGLACBMIXJMD-UHFFFAOYSA-N
MW293.32 g/mol
LogP1.24
Rot. Bonds4

About 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid

3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid (PubChem CID 28932844) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid.

Molecular Properties

Compound Name3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid
PubChem CID28932844
Molecular FormulaC15H19NO5
Molecular Weight293.32 g/mol
Exact Mass293.13
IUPAC Name3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCC(=O)N1CCOCC1
InChIInChI=1S/C15H19NO5/c1-10-7-12(15(18)19)8-11(2)14(10)21-9-13(17)16-3-5-20-6-4-16/h7-8H,3-6,9H2,1-2H3,(H,18,19)
InChIKeyJSKGLACBMIXJMD-UHFFFAOYSA-N
XLogP1.24
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid?
The IUPAC name of 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid (CID 28932844) is 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid.
What is the SMILES notation for 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid?
The canonical SMILES for 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid is Cc1cc(C(=O)O)cc(C)c1OCC(=O)N1CCOCC1.
What is the InChIKey of 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid?
The InChIKey is JSKGLACBMIXJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c1-10-7-12(15(18)19)8-11(2)14(10)21-9-13(17)16-3-5-20-6-4-16/h7-8H,3-6,9H2,1-2H3,(H,18,19).
What are the key properties of 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid?
3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid has a molecular weight of 293.32 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid is sourced from PubChem (CID 28932844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).