C21H26N2O2 — CID 2709723
1-(4-phenylpiperazin-1-yl)-2-(2,4,6-trimethylphenoxy)ethanone (PubChem CID 2709723) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(4-phenylpiperazin-1-yl)-2-(2,4,6-trimethylphenoxy)ethanone.
| Compound Name | 1-(4-phenylpiperazin-1-yl)-2-(2,4,6-trimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 2709723 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(4-phenylpiperazin-1-yl)-2-(2,4,6-trimethylphenoxy)ethanone |
| SMILES | Cc1cc(C)c(OCC(=O)N2CCN(c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-16-13-17(2)21(18(3)14-16)25-15-20(24)23-11-9-22(10-12-23)19-7-5-4-6-8-19/h4-8,13-14H,9-12,15H2,1-3H3 |
| InChIKey | LPHKDSFRYAKCOO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |