C23H23O5- — CID 7732418
2-[2-(4-tert-butylphenyl)-6,7-dimethyl-4-oxochromen-3-yl]oxyacetate (PubChem CID 7732418) has the molecular formula C23H23O5- and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-6,7-dimethyl-4-oxochromen-3-yl]oxyacetate.
| Compound Name | 2-[2-(4-tert-butylphenyl)-6,7-dimethyl-4-oxochromen-3-yl]oxyacetate |
|---|---|
| PubChem CID | 7732418 |
| Molecular Formula | C23H23O5- |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-6,7-dimethyl-4-oxochromen-3-yl]oxyacetate |
| SMILES | Cc1cc2oc(-c3ccc(C(C)(C)C)cc3)c(OCC(=O)[O-])c(=O)c2cc1C |
| InChI | InChI=1S/C23H24O5/c1-13-10-17-18(11-14(13)2)28-21(22(20(17)26)27-12-19(24)25)15-6-8-16(9-7-15)23(3,4)5/h6-11H,12H2,1-5H3,(H,24,25)/p-1 |
| InChIKey | DXXKDDUBHBRHPZ-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |