C25H12Cl2O6 — CID 21001638
(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 2-oxochromene-3-carboxylate (PubChem CID 21001638) has the molecular formula C25H12Cl2O6 and a molecular weight of 479.27 g/mol. Its IUPAC name is (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 2-oxochromene-3-carboxylate.
| Compound Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 21001638 |
| Molecular Formula | C25H12Cl2O6 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 2-oxochromene-3-carboxylate |
| SMILES | O=C(Oc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H12Cl2O6/c26-15-11-16-20(28)23(21(13-6-2-1-3-7-13)32-22(16)18(27)12-15)33-25(30)17-10-14-8-4-5-9-19(14)31-24(17)29/h1-12H |
| InChIKey | JJPHADMKGQGZBB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|