C17H10Cl2O5 — CID 7747825
2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid (PubChem CID 7747825) has the molecular formula C17H10Cl2O5 and a molecular weight of 365.17 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid.
| Compound Name | 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid |
|---|---|
| PubChem CID | 7747825 |
| Molecular Formula | C17H10Cl2O5 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid |
| SMILES | O=C(O)COc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C17H10Cl2O5/c18-10-6-11-14(22)17(23-8-13(20)21)15(9-4-2-1-3-5-9)24-16(11)12(19)7-10/h1-7H,8H2,(H,20,21) |
| InChIKey | SJVGAAPDLVXTDC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |