2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid

C17H10Cl2O5 — CID 7747825

IUPAC2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid
SMILESO=C(O)COc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O
InChIInChI=1S/C17H10Cl2O5/c18-10-6-11-14(22)17(23-8-13(20)21)15(9-4-2-1-3-5-9)24-16(11)12(19)7-10/h1-7H,8H2,(H,20,21)
InChIKeySJVGAAPDLVXTDC-UHFFFAOYSA-N
MW365.17 g/mol
LogP4.23
Rot. Bonds4

About 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid

2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid (PubChem CID 7747825) has the molecular formula C17H10Cl2O5 and a molecular weight of 365.17 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid.

Molecular Properties

Compound Name2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid
PubChem CID7747825
Molecular FormulaC17H10Cl2O5
Molecular Weight365.17 g/mol
Exact Mass363.99
IUPAC Name2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid
SMILESO=C(O)COc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O
InChIInChI=1S/C17H10Cl2O5/c18-10-6-11-14(22)17(23-8-13(20)21)15(9-4-2-1-3-5-9)24-16(11)12(19)7-10/h1-7H,8H2,(H,20,21)
InChIKeySJVGAAPDLVXTDC-UHFFFAOYSA-N
XLogP4.23
TPSA76.74 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.17
LogP ≤ 54.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid?
The IUPAC name of 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid (CID 7747825) is 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid.
What is the SMILES notation for 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid?
The canonical SMILES for 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid is O=C(O)COc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O.
What is the InChIKey of 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid?
The InChIKey is SJVGAAPDLVXTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2O5/c18-10-6-11-14(22)17(23-8-13(20)21)15(9-4-2-1-3-5-9)24-16(11)12(19)7-10/h1-7H,8H2,(H,20,21).
What are the key properties of 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid?
2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid has a molecular weight of 365.17 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxyacetic acid is sourced from PubChem (CID 7747825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).