C26H14BrCl2NO6 — CID 21001629
(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 21001629) has the molecular formula C26H14BrCl2NO6 and a molecular weight of 587.21 g/mol. Its IUPAC name is (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 21001629 |
| Molecular Formula | C26H14BrCl2NO6 |
| Molecular Weight | 587.21 g/mol |
| Exact Mass | 584.94 |
| IUPAC Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)Oc1c(-c2ccccc2)oc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C26H14BrCl2NO6/c27-14-6-7-16-17(10-14)26(34)30(25(16)33)9-8-20(31)35-24-21(32)18-11-15(28)12-19(29)23(18)36-22(24)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2 |
| InChIKey | AADNGUIZUYUQMG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.21 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|