C25H13BrClNO6 — CID 21000198
(6-chloro-4-oxo-2-phenylchromen-3-yl) 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 21000198) has the molecular formula C25H13BrClNO6 and a molecular weight of 538.74 g/mol. Its IUPAC name is (6-chloro-4-oxo-2-phenylchromen-3-yl) 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (6-chloro-4-oxo-2-phenylchromen-3-yl) 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 21000198 |
| Molecular Formula | C25H13BrClNO6 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 536.96 |
| IUPAC Name | (6-chloro-4-oxo-2-phenylchromen-3-yl) 2-(5-bromo-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccc(Br)cc2C1=O)Oc1c(-c2ccccc2)oc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C25H13BrClNO6/c26-14-6-8-16-17(10-14)25(32)28(24(16)31)12-20(29)34-23-21(30)18-11-15(27)7-9-19(18)33-22(23)13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | BNACUWBTZPVIJP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|