C21H14ClNO5S — CID 175508448
5-[(6-chloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]-N-hydroxythiophene-2-carboxamide (PubChem CID 175508448) has the molecular formula C21H14ClNO5S and a molecular weight of 427.87 g/mol. Its IUPAC name is 5-[(6-chloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-[(6-chloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 175508448 |
| Molecular Formula | C21H14ClNO5S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 5-[(6-chloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]-N-hydroxythiophene-2-carboxamide |
| SMILES | O=C(NO)c1ccc(COc2c(-c3ccccc3)oc3ccc(Cl)cc3c2=O)s1 |
| InChI | InChI=1S/C21H14ClNO5S/c22-13-6-8-16-15(10-13)18(24)20(19(28-16)12-4-2-1-3-5-12)27-11-14-7-9-17(29-14)21(25)23-26/h1-10,26H,11H2,(H,23,25) |
| InChIKey | QAFAXGCHLVTBBK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|