C21H12Cl2O6 — CID 21000428
5-[[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxymethyl]furan-2-carboxylic acid (PubChem CID 21000428) has the molecular formula C21H12Cl2O6 and a molecular weight of 431.23 g/mol. Its IUPAC name is 5-[[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 21000428 |
| Molecular Formula | C21H12Cl2O6 |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 5-[[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxymethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2c(-c3ccc(Cl)cc3)oc3ccc(Cl)cc3c2=O)o1 |
| InChI | InChI=1S/C21H12Cl2O6/c22-12-3-1-11(2-4-12)19-20(27-10-14-6-8-17(28-14)21(25)26)18(24)15-9-13(23)5-7-16(15)29-19/h1-9H,10H2,(H,25,26) |
| InChIKey | UGUYGWCJINQXHL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |