C23H15ClFNO4 — CID 21000237
2-(6-chloro-4-oxo-2-phenylchromen-3-yl)oxy-N-(2-fluorophenyl)acetamide (PubChem CID 21000237) has the molecular formula C23H15ClFNO4 and a molecular weight of 423.83 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-2-phenylchromen-3-yl)oxy-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(6-chloro-4-oxo-2-phenylchromen-3-yl)oxy-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21000237 |
| Molecular Formula | C23H15ClFNO4 |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-(6-chloro-4-oxo-2-phenylchromen-3-yl)oxy-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1c(-c2ccccc2)oc2ccc(Cl)cc2c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H15ClFNO4/c24-15-10-11-19-16(12-15)21(28)23(22(30-19)14-6-2-1-3-7-14)29-13-20(27)26-18-9-5-4-8-17(18)25/h1-12H,13H2,(H,26,27) |
| InChIKey | MMGAPXCMPGSEFG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |