C23H14Cl2FNO4 — CID 21000460
2-[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxy-N-(2-fluorophenyl)acetamide (PubChem CID 21000460) has the molecular formula C23H14Cl2FNO4 and a molecular weight of 458.27 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxy-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxy-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21000460 |
| Molecular Formula | C23H14Cl2FNO4 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 2-[6-chloro-2-(4-chlorophenyl)-4-oxochromen-3-yl]oxy-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1c(-c2ccc(Cl)cc2)oc2ccc(Cl)cc2c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H14Cl2FNO4/c24-14-7-5-13(6-8-14)22-23(21(29)16-11-15(25)9-10-19(16)31-22)30-12-20(28)27-18-4-2-1-3-17(18)26/h1-11H,12H2,(H,27,28) |
| InChIKey | YTRFJWAMMFEJEN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |