C23H14Cl2O5 — CID 21001633
(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate (PubChem CID 21001633) has the molecular formula C23H14Cl2O5 and a molecular weight of 441.27 g/mol. Its IUPAC name is (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate.
| Compound Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate |
|---|---|
| PubChem CID | 21001633 |
| Molecular Formula | C23H14Cl2O5 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2c(-c3ccccc3)oc3c(Cl)cc(Cl)cc3c2=O)c1 |
| InChI | InChI=1S/C23H14Cl2O5/c1-28-16-9-5-8-14(10-16)23(27)30-22-19(26)17-11-15(24)12-18(25)21(17)29-20(22)13-6-3-2-4-7-13/h2-12H,1H3 |
| InChIKey | PXGWUUKFJFCMLP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |