(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate

C23H14Cl2O5 — CID 21001633

IUPAC(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate
SMILESCOc1cccc(C(=O)Oc2c(-c3ccccc3)oc3c(Cl)cc(Cl)cc3c2=O)c1
InChIInChI=1S/C23H14Cl2O5/c1-28-16-9-5-8-14(10-16)23(27)30-22-19(26)17-11-15(24)12-18(25)21(17)29-20(22)13-6-3-2-4-7-13/h2-12H,1H3
InChIKeyPXGWUUKFJFCMLP-UHFFFAOYSA-N
MW441.27 g/mol
LogP5.99
Rot. Bonds4

About (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate

(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate (PubChem CID 21001633) has the molecular formula C23H14Cl2O5 and a molecular weight of 441.27 g/mol. Its IUPAC name is (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate.

Molecular Properties

Compound Name(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate
PubChem CID21001633
Molecular FormulaC23H14Cl2O5
Molecular Weight441.27 g/mol
Exact Mass440.02
IUPAC Name(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate
SMILESCOc1cccc(C(=O)Oc2c(-c3ccccc3)oc3c(Cl)cc(Cl)cc3c2=O)c1
InChIInChI=1S/C23H14Cl2O5/c1-28-16-9-5-8-14(10-16)23(27)30-22-19(26)17-11-15(24)12-18(25)21(17)29-20(22)13-6-3-2-4-7-13/h2-12H,1H3
InChIKeyPXGWUUKFJFCMLP-UHFFFAOYSA-N
XLogP5.99
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500441.27
LogP ≤ 55.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate?
The IUPAC name of (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate (CID 21001633) is (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate.
What is the SMILES notation for (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate?
The canonical SMILES for (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate is COc1cccc(C(=O)Oc2c(-c3ccccc3)oc3c(Cl)cc(Cl)cc3c2=O)c1.
What is the InChIKey of (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate?
The InChIKey is PXGWUUKFJFCMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2O5/c1-28-16-9-5-8-14(10-16)23(27)30-22-19(26)17-11-15(24)12-18(25)21(17)29-20(22)13-6-3-2-4-7-13/h2-12H,1H3.
What are the key properties of (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate?
(6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate has a molecular weight of 441.27 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6,8-dichloro-4-oxo-2-phenylchromen-3-yl) 3-methoxybenzoate is sourced from PubChem (CID 21001633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).