C17H13NO5 — CID 23906269
(4-hydroxyphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 23906269) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is (4-hydroxyphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (4-hydroxyphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 23906269 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (4-hydroxyphenyl) 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C17H13NO5/c19-11-5-7-12(8-6-11)23-15(20)9-10-18-16(21)13-3-1-2-4-14(13)17(18)22/h1-8,19H,9-10H2 |
| InChIKey | OLGGFRXNKAKRRI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|