C24H16N2O4S — CID 39964683
[4-(1,3-benzothiazol-2-yl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 39964683) has the molecular formula C24H16N2O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [4-(1,3-benzothiazol-2-yl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 39964683 |
| Molecular Formula | C24H16N2O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Oc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H16N2O4S/c27-21(13-14-26-23(28)17-5-1-2-6-18(17)24(26)29)30-16-11-9-15(10-12-16)22-25-19-7-3-4-8-20(19)31-22/h1-12H,13-14H2 |
| InChIKey | ZLJYCZXYDLTSKL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|