C20H18N2O2S — CID 1026408
5-(1,3-benzothiazol-2-yl)-2-(3-methylbutyl)isoindole-1,3-dione (PubChem CID 1026408) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-2-(3-methylbutyl)isoindole-1,3-dione.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-2-(3-methylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 1026408 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-2-(3-methylbutyl)isoindole-1,3-dione |
| SMILES | CC(C)CCN1C(=O)c2ccc(-c3nc4ccccc4s3)cc2C1=O |
| InChI | InChI=1S/C20H18N2O2S/c1-12(2)9-10-22-19(23)14-8-7-13(11-15(14)20(22)24)18-21-16-5-3-4-6-17(16)25-18/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | NOTBGPPHISGIIX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|