C22H14N4O3S — CID 112806736
N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 112806736) has the molecular formula C22H14N4O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 112806736 |
| Molecular Formula | C22H14N4O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3ccc(-c4nc5ccccc5s4)cn3)cc2C1=O |
| InChI | InChI=1S/C22H14N4O3S/c1-26-21(28)14-8-6-12(10-15(14)22(26)29)19(27)25-18-9-7-13(11-23-18)20-24-16-4-2-3-5-17(16)30-20/h2-11H,1H3,(H,23,25,27) |
| InChIKey | SKIHIMPUNOELEP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|