C19H12N4O3S — CID 112771297
N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-3-nitrobenzamide (PubChem CID 112771297) has the molecular formula C19H12N4O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-3-nitrobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 112771297 |
| Molecular Formula | C19H12N4O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cn1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O3S/c24-18(12-4-3-5-14(10-12)23(25)26)22-17-9-8-13(11-20-17)19-21-15-6-1-2-7-16(15)27-19/h1-11H,(H,20,22,24) |
| InChIKey | XKXGLTUJLBQUJK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|