C19H12N4O3S — CID 7141326
3-nitro-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide (PubChem CID 7141326) has the molecular formula C19H12N4O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is 3-nitro-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3-nitro-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7141326 |
| Molecular Formula | C19H12N4O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-nitro-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3cccnc3s2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O3S/c24-17(12-4-2-7-15(11-12)23(25)26)21-14-6-1-5-13(10-14)18-22-16-8-3-9-20-19(16)27-18/h1-11H,(H,21,24) |
| InChIKey | GUSFTFCQAFBVAC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|