C15H11N3O3S — CID 976614
2-methyl-N-(3-nitrophenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 976614) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-methyl-N-(3-nitrophenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-methyl-N-(3-nitrophenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 976614 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-methyl-N-(3-nitrophenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3cccc([N+](=O)[O-])c3)cc2s1 |
| InChI | InChI=1S/C15H11N3O3S/c1-9-16-13-6-5-10(7-14(13)22-9)15(19)17-11-3-2-4-12(8-11)18(20)21/h2-8H,1H3,(H,17,19) |
| InChIKey | PBEQYYYZRZFWIS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|