C15H11BrN2OS — CID 126196449
N-(3-bromophenyl)-2-methyl-1,3-benzothiazole-6-carboxamide (PubChem CID 126196449) has the molecular formula C15H11BrN2OS and a molecular weight of 347.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-methyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(3-bromophenyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 126196449 |
| Molecular Formula | C15H11BrN2OS |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | N-(3-bromophenyl)-2-methyl-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3cccc(Br)c3)cc2s1 |
| InChI | InChI=1S/C15H11BrN2OS/c1-9-17-13-6-5-10(7-14(13)20-9)15(19)18-12-4-2-3-11(16)8-12/h2-8H,1H3,(H,18,19) |
| InChIKey | PWVLRQMQCWPFIW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |