C19H9F4N3OS — CID 112772707
N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 112772707) has the molecular formula C19H9F4N3OS and a molecular weight of 403.36 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 112772707 |
| Molecular Formula | C19H9F4N3OS |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cn1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H9F4N3OS/c20-11-7-10(15(21)17(23)16(11)22)18(27)26-14-6-5-9(8-24-14)19-25-12-3-1-2-4-13(12)28-19/h1-8H,(H,24,26,27) |
| InChIKey | RUESWDSKLQNXSG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|