C22H16N4O3S2 — CID 17104281
N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-nitrobenzamide (PubChem CID 17104281) has the molecular formula C22H16N4O3S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 17104281 |
| Molecular Formula | C22H16N4O3S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)NCc1ccc(-c2nc3ccccc3s2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N4O3S2/c27-20(16-4-3-5-17(12-16)26(28)29)25-22(30)23-13-14-8-10-15(11-9-14)21-24-18-6-1-2-7-19(18)31-21/h1-12H,13H2,(H2,23,25,27,30) |
| InChIKey | LYRTYVPQWCNPEA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|