C21H16N4O5S — CID 46464152
N-[2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 46464152) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46464152 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)NCc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C21H16N4O5S/c26-19(12-23-20(27)13-4-3-5-14(10-13)25(28)29)22-11-15-8-9-17(30-15)21-24-16-6-1-2-7-18(16)31-21/h1-10H,11-12H2,(H,22,26)(H,23,27) |
| InChIKey | VYZSFCNEGHHBGD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|