C22H15N5O4S — CID 55758358
N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 55758358) has the molecular formula C22H15N5O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55758358 |
| Molecular Formula | C22H15N5O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(-c2nc3ccccc3s2)o1)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C22H15N5O4S/c28-21(14-11-24-26(13-14)15-5-7-16(8-6-15)27(29)30)23-12-17-9-10-19(31-17)22-25-18-3-1-2-4-20(18)32-22/h1-11,13H,12H2,(H,23,28) |
| InChIKey | VTVZZGJQHHTNDO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|