C20H17N5O3 — CID 55702555
N-[2-(1H-indol-3-yl)ethyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 55702555) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55702555 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H17N5O3/c26-20(21-10-9-14-11-22-19-4-2-1-3-18(14)19)15-12-23-24(13-15)16-5-7-17(8-6-16)25(27)28/h1-8,11-13,22H,9-10H2,(H,21,26) |
| InChIKey | ATRMOHKQDZDFNK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|