C16H21ClN6O3 — CID 119447389
1-(4-nitrophenyl)-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide;hydrochloride (PubChem CID 119447389) has the molecular formula C16H21ClN6O3 and a molecular weight of 380.84 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-nitrophenyl)-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119447389 |
| Molecular Formula | C16H21ClN6O3 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-(4-nitrophenyl)-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H20N6O3.ClH/c23-16(18-7-10-20-8-5-17-6-9-20)13-11-19-21(12-13)14-1-3-15(4-2-14)22(24)25;/h1-4,11-12,17H,5-10H2,(H,18,23);1H |
| InChIKey | GPEYQOFNQKOMAD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|