C12H21ClN6O3 — CID 119446899
3-(4-nitropyrazol-1-yl)-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride (PubChem CID 119446899) has the molecular formula C12H21ClN6O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 3-(4-nitropyrazol-1-yl)-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-(4-nitropyrazol-1-yl)-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119446899 |
| Molecular Formula | C12H21ClN6O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-(4-nitropyrazol-1-yl)-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCn1cc([N+](=O)[O-])cn1)NCCN1CCNCC1 |
| InChI | InChI=1S/C12H20N6O3.ClH/c19-12(14-4-8-16-6-2-13-3-7-16)1-5-17-10-11(9-15-17)18(20)21;/h9-10,13H,1-8H2,(H,14,19);1H |
| InChIKey | XODRULJHAIMIOM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|