C10H11ClN6O3 — CID 19281846
2-(4-chloropyrazol-1-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]acetamide (PubChem CID 19281846) has the molecular formula C10H11ClN6O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is 2-(4-chloropyrazol-1-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-chloropyrazol-1-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 19281846 |
| Molecular Formula | C10H11ClN6O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(4-chloropyrazol-1-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]acetamide |
| SMILES | O=C(Cn1cc(Cl)cn1)NCCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H11ClN6O3/c11-8-3-13-16(5-8)7-10(18)12-1-2-15-6-9(4-14-15)17(19)20/h3-6H,1-2,7H2,(H,12,18) |
| InChIKey | SOTQXQZZCLNLIX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|