C11H12ClN5O3 — CID 19622359
1-[2-[2-(4-chloropyrazol-1-yl)ethylamino]-2-oxoethyl]pyrazole-4-carboxylic acid (PubChem CID 19622359) has the molecular formula C11H12ClN5O3 and a molecular weight of 297.70 g/mol. Its IUPAC name is 1-[2-[2-(4-chloropyrazol-1-yl)ethylamino]-2-oxoethyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[2-[2-(4-chloropyrazol-1-yl)ethylamino]-2-oxoethyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19622359 |
| Molecular Formula | C11H12ClN5O3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 1-[2-[2-(4-chloropyrazol-1-yl)ethylamino]-2-oxoethyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)cn1)NCCn1cc(Cl)cn1 |
| InChI | InChI=1S/C11H12ClN5O3/c12-9-4-15-16(6-9)2-1-13-10(18)7-17-5-8(3-14-17)11(19)20/h3-6H,1-2,7H2,(H,13,18)(H,19,20) |
| InChIKey | IXLUOWYRZHECDB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |