C7H9N5O4 — CID 60733166
2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]acetamide (PubChem CID 60733166) has the molecular formula C7H9N5O4 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]acetamide.
| Compound Name | 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 60733166 |
| Molecular Formula | C7H9N5O4 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]acetamide |
| SMILES | NC(=O)CNC(=O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C7H9N5O4/c8-6(13)2-9-7(14)4-11-3-5(1-10-11)12(15)16/h1,3H,2,4H2,(H2,8,13)(H,9,14) |
| InChIKey | MXPDWPLGLQUOHX-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|