C9H16ClN5O3 — CID 119496278
N-(3-aminobutyl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride (PubChem CID 119496278) has the molecular formula C9H16ClN5O3 and a molecular weight of 277.71 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119496278 |
| Molecular Formula | C9H16ClN5O3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(3-aminobutyl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)Cn1cc([N+](=O)[O-])cn1.Cl |
| InChI | InChI=1S/C9H15N5O3.ClH/c1-7(10)2-3-11-9(15)6-13-5-8(4-12-13)14(16)17;/h4-5,7H,2-3,6,10H2,1H3,(H,11,15);1H |
| InChIKey | XBBQBINIBSGXNK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|