C14H17N7O6 — CID 19471051
1-[1-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethylamino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid (PubChem CID 19471051) has the molecular formula C14H17N7O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-[1-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethylamino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethylamino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19471051 |
| Molecular Formula | C14H17N7O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[1-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethylamino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CC(C(=O)NCCNC(=O)Cn1cc([N+](=O)[O-])cn1)n1cc(C(=O)O)cn1 |
| InChI | InChI=1S/C14H17N7O6/c1-9(20-6-10(4-18-20)14(24)25)13(23)16-3-2-15-12(22)8-19-7-11(5-17-19)21(26)27/h4-7,9H,2-3,8H2,1H3,(H,15,22)(H,16,23)(H,24,25) |
| InChIKey | VJHHDBMYLRPRAL-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|