C20H16BrN3O5 — CID 24588464
N-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 24588464) has the molecular formula C20H16BrN3O5 and a molecular weight of 458.27 g/mol. Its IUPAC name is N-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24588464 |
| Molecular Formula | C20H16BrN3O5 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | N-[2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C20H16BrN3O5/c21-15-6-4-13(5-7-15)18-9-8-17(29-18)11-22-19(25)12-23-20(26)14-2-1-3-16(10-14)24(27)28/h1-10H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | NWEDAKVPMVVGQD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|