C20H21N3OS2 — CID 3499117
N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-methylbutanamide (PubChem CID 3499117) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3499117 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methylcarbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)NCc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H21N3OS2/c1-13(2)11-18(24)23-20(25)21-12-14-7-9-15(10-8-14)19-22-16-5-3-4-6-17(16)26-19/h3-10,13H,11-12H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | LCHMCLONLCJPAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|