C20H23N3O2S2 — CID 21211861
N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methylbutanamide;hydrate (PubChem CID 21211861) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methylbutanamide;hydrate.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methylbutanamide;hydrate |
|---|---|
| PubChem CID | 21211861 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methylbutanamide;hydrate |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1NC(=S)NC(=O)CC(C)C.O |
| InChI | InChI=1S/C20H21N3OS2.H2O/c1-12(2)10-18(24)23-20(25)22-16-11-14(9-8-13(16)3)19-21-15-6-4-5-7-17(15)26-19;/h4-9,11-12H,10H2,1-3H3,(H2,22,23,24,25);1H2 |
| InChIKey | PVABHNHKPHUZGM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|