C24H20ClN3O2S2 — CID 4227017
N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-2-(4-chloro-2-methylphenoxy)acetamide (PubChem CID 4227017) has the molecular formula C24H20ClN3O2S2 and a molecular weight of 482.03 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-2-(4-chloro-2-methylphenoxy)acetamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-2-(4-chloro-2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4227017 |
| Molecular Formula | C24H20ClN3O2S2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-2-(4-chloro-2-methylphenoxy)acetamide |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1NC(=S)NC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C24H20ClN3O2S2/c1-14-7-8-16(23-26-18-5-3-4-6-21(18)32-23)12-19(14)27-24(31)28-22(29)13-30-20-10-9-17(25)11-15(20)2/h3-12H,13H2,1-2H3,(H2,27,28,29,31) |
| InChIKey | YLBLBQVCORODSQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|