C21H16N4OS2 — CID 1207600
N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 1207600) has the molecular formula C21H16N4OS2 and a molecular weight of 404.52 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1207600 |
| Molecular Formula | C21H16N4OS2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1NC(=S)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C21H16N4OS2/c1-13-8-9-14(20-23-16-6-2-3-7-18(16)28-20)11-17(13)24-21(27)25-19(26)15-5-4-10-22-12-15/h2-12H,1H3,(H2,24,25,26,27) |
| InChIKey | DCXFLIMXABDIIR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|