C22H14N2O3S — CID 1294824
5-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)isoindole-1,3-dione (PubChem CID 1294824) has the molecular formula C22H14N2O3S and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 1294824 |
| Molecular Formula | C22H14N2O3S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)isoindole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccc(-c4nc5ccccc5s4)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H14N2O3S/c1-27-15-9-7-14(8-10-15)24-21(25)16-11-6-13(12-17(16)22(24)26)20-23-18-4-2-3-5-19(18)28-20/h2-12H,1H3 |
| InChIKey | UPHSRIFUKVILQR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|