C16H15NO3S — CID 627307
2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole (PubChem CID 627307) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 627307 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1,3-benzothiazole |
| SMILES | COc1cc(-c2nc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C16H15NO3S/c1-18-12-8-10(9-13(19-2)15(12)20-3)16-17-11-6-4-5-7-14(11)21-16/h4-9H,1-3H3 |
| InChIKey | OWRCNKRRSJRMCC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |