C28H22N2O4S2 — CID 161368549
5-(1,3-benzothiazol-2-yl)-2-methoxyphenol (PubChem CID 161368549) has the molecular formula C28H22N2O4S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-2-methoxyphenol.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-2-methoxyphenol |
|---|---|
| PubChem CID | 161368549 |
| Molecular Formula | C28H22N2O4S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-2-methoxyphenol |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1O.COc1ccc(-c2nc3ccccc3s2)cc1O |
| InChI | InChI=1S/2C14H11NO2S/c2*1-17-12-7-6-9(8-11(12)16)14-15-10-4-2-3-5-13(10)18-14/h2*2-8,16H,1H3 |
| InChIKey | VQDPTXNXFNJPGV-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |