2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid

C18H17NO4S — CID 22307126

IUPAC2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid
SMILESCCC(Oc1ccc(-c2nc3ccccc3s2)cc1OC)C(=O)O
InChIInChI=1S/C18H17NO4S/c1-3-13(18(20)21)23-14-9-8-11(10-15(14)22-2)17-19-12-6-4-5-7-16(12)24-17/h4-10,13H,3H2,1-2H3,(H,20,21)
InChIKeyQTYVLJLSVFUFIL-UHFFFAOYSA-N
MW343.40 g/mol
LogP4.21
Rot. Bonds6

About 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid

2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid (PubChem CID 22307126) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid.

Molecular Properties

Compound Name2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid
PubChem CID22307126
Molecular FormulaC18H17NO4S
Molecular Weight343.40 g/mol
Exact Mass343.09
IUPAC Name2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid
SMILESCCC(Oc1ccc(-c2nc3ccccc3s2)cc1OC)C(=O)O
InChIInChI=1S/C18H17NO4S/c1-3-13(18(20)21)23-14-9-8-11(10-15(14)22-2)17-19-12-6-4-5-7-16(12)24-17/h4-10,13H,3H2,1-2H3,(H,20,21)
InChIKeyQTYVLJLSVFUFIL-UHFFFAOYSA-N
XLogP4.21
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.40
LogP ≤ 54.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid?
The IUPAC name of 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid (CID 22307126) is 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid.
What is the SMILES notation for 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid?
The canonical SMILES for 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid is CCC(Oc1ccc(-c2nc3ccccc3s2)cc1OC)C(=O)O.
What is the InChIKey of 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid?
The InChIKey is QTYVLJLSVFUFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4S/c1-3-13(18(20)21)23-14-9-8-11(10-15(14)22-2)17-19-12-6-4-5-7-16(12)24-17/h4-10,13H,3H2,1-2H3,(H,20,21).
What are the key properties of 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid?
2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid has a molecular weight of 343.40 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butanoic acid is sourced from PubChem (CID 22307126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).