C15H13NO3S — CID 136746012
2-(1,3-benzothiazol-2-yl)-3,5-dimethoxyphenol (PubChem CID 136746012) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3,5-dimethoxyphenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 136746012 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(-c2nc3ccccc3s2)c(OC)c1 |
| InChI | InChI=1S/C15H13NO3S/c1-18-9-7-11(17)14(12(8-9)19-2)15-16-10-5-3-4-6-13(10)20-15/h3-8,17H,1-2H3 |
| InChIKey | WLAXBTPOHVCOTL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |