C14H10FNO2S — CID 136789802
3-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)phenol (PubChem CID 136789802) has the molecular formula C14H10FNO2S and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 3-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 136789802 |
| Molecular Formula | C14H10FNO2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)phenol |
| SMILES | COc1ccc2nc(-c3c(O)cccc3F)sc2c1 |
| InChI | InChI=1S/C14H10FNO2S/c1-18-8-5-6-10-12(7-8)19-14(16-10)13-9(15)3-2-4-11(13)17/h2-7,17H,1H3 |
| InChIKey | YWZIJMUOSFRBFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |