C42H28N2O2S2 — CID 22960185
6-methoxy-2-[4-[10-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]phenyl]-1,3-benzothiazole (PubChem CID 22960185) has the molecular formula C42H28N2O2S2 and a molecular weight of 656.83 g/mol. Its IUPAC name is 6-methoxy-2-[4-[10-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-[4-[10-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 22960185 |
| Molecular Formula | C42H28N2O2S2 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | 6-methoxy-2-[4-[10-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]anthracen-9-yl]phenyl]-1,3-benzothiazole |
| SMILES | COc1ccc2nc(-c3ccc(-c4c5ccccc5c(-c5ccc(-c6nc7ccc(OC)cc7s6)cc5)c5ccccc45)cc3)sc2c1 |
| InChI | InChI=1S/C42H28N2O2S2/c1-45-29-19-21-35-37(23-29)47-41(43-35)27-15-11-25(12-16-27)39-31-7-3-5-9-33(31)40(34-10-6-4-8-32(34)39)26-13-17-28(18-14-26)42-44-36-22-20-30(46-2)24-38(36)48-42/h3-24H,1-2H3 |
| InChIKey | JACAVKUUIJERME-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|