C22H16N2O2S2 — CID 58983612
2,6-bis(4-methoxyphenyl)-[1,3]thiazolo[4,5-f][1,3]benzothiazole (PubChem CID 58983612) has the molecular formula C22H16N2O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-[1,3]thiazolo[4,5-f][1,3]benzothiazole.
| Compound Name | 2,6-bis(4-methoxyphenyl)-[1,3]thiazolo[4,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 58983612 |
| Molecular Formula | C22H16N2O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-[1,3]thiazolo[4,5-f][1,3]benzothiazole |
| SMILES | COc1ccc(-c2nc3cc4nc(-c5ccc(OC)cc5)sc4cc3s2)cc1 |
| InChI | InChI=1S/C22H16N2O2S2/c1-25-15-7-3-13(4-8-15)21-23-17-11-18-20(12-19(17)27-21)28-22(24-18)14-5-9-16(26-2)10-6-14/h3-12H,1-2H3 |
| InChIKey | QAYCYEVDVKTCDR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |