C22H19NO2S — CID 146253203
2-[4-(4-ethoxyphenyl)phenyl]-6-methoxy-1,3-benzothiazole (PubChem CID 146253203) has the molecular formula C22H19NO2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)phenyl]-6-methoxy-1,3-benzothiazole.
| Compound Name | 2-[4-(4-ethoxyphenyl)phenyl]-6-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 146253203 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)phenyl]-6-methoxy-1,3-benzothiazole |
| SMILES | CCOc1ccc(-c2ccc(-c3nc4ccc(OC)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO2S/c1-3-25-18-10-8-16(9-11-18)15-4-6-17(7-5-15)22-23-20-13-12-19(24-2)14-21(20)26-22/h4-14H,3H2,1-2H3 |
| InChIKey | UEIIPYXEMNLBBP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |