C14H10Cl2N2OS — CID 82830716
2,6-dichloro-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline (PubChem CID 82830716) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is 2,6-dichloro-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2,6-dichloro-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 82830716 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2,6-dichloro-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
| SMILES | COc1ccc2nc(-c3cc(Cl)c(N)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c1-19-8-2-3-11-12(6-8)20-14(18-11)7-4-9(15)13(17)10(16)5-7/h2-6H,17H2,1H3 |
| InChIKey | QHCNMUNGBGDWBG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|