C11H10N4OS — CID 79511841
5-(6-methoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 79511841) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 5-(6-methoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(6-methoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 79511841 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(6-methoxy-1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | COc1ccc2nc(-c3cc(N)n[nH]3)sc2c1 |
| InChI | InChI=1S/C11H10N4OS/c1-16-6-2-3-7-9(4-6)17-11(13-7)8-5-10(12)15-14-8/h2-5H,1H3,(H3,12,14,15) |
| InChIKey | KOPMFQSRDMLALA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |