C14H11BrN2OS — CID 79512202
4-bromo-2-(6-methoxy-1,3-benzothiazol-2-yl)aniline (PubChem CID 79512202) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-bromo-2-(6-methoxy-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 4-bromo-2-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 79512202 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 4-bromo-2-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
| SMILES | COc1ccc2nc(-c3cc(Br)ccc3N)sc2c1 |
| InChI | InChI=1S/C14H11BrN2OS/c1-18-9-3-5-12-13(7-9)19-14(17-12)10-6-8(15)2-4-11(10)16/h2-7H,16H2,1H3 |
| InChIKey | PSOKATZWIPGJGR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|